- CAS Number
- Product Names
- Molecular Formula
| 70247-99-3 | Poly(oxy-1,2-ethanediyl),.alpha.-hydro-.omega.-hydroxy-,mono-C4-18-alkyl ethers,phosphates,potassium salts |
| 23149-81-7 | Pyrimido[5,4-d]pyrimidine-4,8-diamine | C6H6 N6 |
| 26969-09-5 | Poly[imino-1,4-butanediylimino(1,12-dioxo-1,12-dodecanediyl)] | (C16H30 N2 O2)n |
| 94114-12-2 | Pitch, coalgasification tar, low-temp. |
| 52246-70-5 | Phosphoric acid,diethyl ester, gallium salt (9CI) | C4H11 O4 P . 1/3 Ga |
| 93841-13-5 | piperazine-1-propanesulphonic acid | C7H16 N2 O3 S |
| 61723-78-2 | Poly(oxy-1,2-ethanediyl),a-isooctyl-w-hydroxy- | (C2H4 O)n C8 H18 O |
| 34216-79-0 | Poly[nitrilo(1,2-diphenyl-1,2-ethanediylidene)nitrilo[1,1'-biphenyl]-4,4'-diyl] | (C26H18 N2)n |
| 102233-00-1 | Pyrido[2,3-d]pyrimidine-5-carboxylicacid, 1,2,3,4-tetrahydro-7-methyl-2,4-dioxo-1-phenyl-, ethyl ester | C17H15 N3 O4 |
| 51264-33-6 | Phenol,4-[(4-hydroxyphenyl)-2-pyridinylmethyl]-, 1-(hydrogen sulfate) (9CI) | C18H15 N O5 S |
| 66895-59-8 | Pentadecanoic acid,4,12-dihydroxy- (9CI) | C15H30 O4 |
| 90082-86-3 | Plantain, Plantagoovata, ext. |
| 84057-81-8 | POLYVINYLPYRROLIDONE | C16H20O8Zr |
| 61580-84-5 | Poly(oxy-1,2-ethanediyl),a,a'-[oxybis(methyl-2,1-ethanediyl)]bis[w-hydroxy- | (C2H4 O)n (C2 H4 O)n C6 H14 O3 |
| 25404-21-1 | Phosphinic acid,(3-chloro-3-oxopropyl)- (9CI) | C3H6 Cl O3 P |
| 42095-80-7 | Propionic acid 2-(p-bromophenyl)hydrazide | C9H11 Br N2 O |
| 71156-53-1 | Pepto-bismol |
| 21943-18-0 | Piperazine, 1,4-bis(1-methylethyl)- (9CI) | C10H22 N2 |
| 17284-65-0 | P,P'-Diamidotetrathioperoxydiphosphoricacid ([(HO)(H2N)P(S)]2S2), N,N'-diethyl-N,N'-dioctadecyl-, diethyl ester (9CI) | C44H94 N2 O2 P2 S4 |
| 159226-00-3 | Prolinamide,N,N-dimethylleucyl-N-[5,8-dioxo-3-phenyl-7-(phenylmethyl)-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-10,12,14,15-tetraen-4-yl]-(9CI) | C39H47 N5 O5 |
| 54548-50-4 | Phenol, 3-methyl-,monochloro deriv. | C7H7 Cl O |
| 123739-10-6 | Phenol, 4,4-(1-methylethylidene)bis-, polymer with (chloromethyl)oxirane and N,N-diethyl-1,3-propanediamine |
| 155673-89-5 | Pyrimidine,1,1'-(1,7-heptanediyl)bis[3-acetylhexahydro- (9CI) | C19H36 N4 O2 |
| 83929-23-1 | potassium octyl phosphonate | C8H19 O3 P . K |
| 14020-51-0 | Powellite (Ca(MoO4)) |
| 38636-85-0 | Pregn-5-ene-3,12,16-triol,20-[(2R,5S)-5-methyl-2-piperidinyl]-, 3-acetate, (3b,12a,16a,20S)- (9CI) | C29H47 N O4 |
| 50862-53-8 | polyoctamethylene oxide | C8 H16 O |
| 4798-75-8 | phenyl bis(2-chloroethyl)phosphoramidochloridate | C10H13 Cl3 N O2 P |
| 501-82-6 | phenylcarbamic acid | C7H7 N O2 |
| 68131-32-8 | Pulpingliquors, spent, fermented |
| 141931-06-8 | Phosphorodiamidothioicacid, N,N-diethyl-N',N'-dimethyl-, S-methyl ester | C7H19 N2 O P S |
| 22865-48-1 | p-[(p-nitrophenyl)thio]toluene | C13H11 N O2 S |
| 95009-55-5 | Phosphatides,mycobacterium phlei |
| 35280-74-1 | Phosphine selenide(9CI) | H3P Se |
| 260-67-3 | Pyrido[3,2-g]quinoline(8CI,9CI) | C12H8 N2 |
| 56319-00-7 | Phenol,4,4'-(2,3-dimethyl-1,4-butanediyl)bis- (9CI) | C18H22 O2 |
| 17042-62-5 | Pyrazino[1,2,3,4-lmn][1,10]phenanthrolinediium(8CI,9CI) | C14H10 N2 |
| 121-29-9 | PYRETHRIN 2 | C22H28 O5 |
| 4455-09-8 | PENTAFLUOROBENZYL P-TOLUENESULFONATE | C15H16 O3 S |
| 151751-86-9 | Poly[oxycarbonyl[2,5-bis(hexyloxy)-1,4-phenylene]carbonyloxy[1,1'-biphenyl]-4,4'-diyl] | (C32H36 O6)n |
| 146161-78-6 | Propanoic acid,compounds,mixt. with ammonium dipropanoate |
| 88357-69-1 | Poly(oxy-1,2-ethanediyl),a-[2-(trimethylammonio)ethyl]-w-[2-(trimethylammonio)ethoxy]-,chloride (1:2) | (C2H4 O)n C10 H26 N2 O . 2 Cl |
| 13525-99-0 | Phosphinic acid,P,P-bis(2-ethylhexyl)- | C16H35 O2 P |
| 13779-10-7 | promethium trichloride | Cl3Pm |
| 73570-67-9 | p-phenylenebis[(2-hydroxyethyl)dimethylammonium] dichloride | C16H30 N2 O2 . 2 Cl |
| 49847-97-4 | Prorenoate potassium | C3H3KO2 |
| 159634-24-9 | Propanamide,2-amino-N-[(1R)-1-[[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4'-piperidin]-1'-yl]carbonyl]-4-phenylbutyl]-2-methyl-,hydrochloride (1:1) | C28H38 N4 O4 S . Cl H |
| 66771-90-2 | Plexafer F |
| 25540-52-7 | Phosphonohydrazidicacid, 2-(hydroxyphosphinyl)- (9CI) | H6N2 O4 P2 |
| 54835-75-5 | Phacidin | C16H22 O5 |
| 172890-54-9 | Pyridinium, alkyl1-[2-[2-(C12-16-alkyldimethylammonio)ethoxy]ethyl] derivs., dichlorides |
| 25758-64-9 | Phosphorohydrazidodithioicacid (8CI,9CI) | H5N2 O P S2 |
| 102381-79-3 | Protrazine (9CI) |
| 102612-62-4 | Pentanoic acid,5-amino-4-[(cyanonitrosoamino)methyl]-5-oxo-, phenylmethyl ester | C14H16 N4 O4 |
| 87658-81-9 | Palanil Navy Blue TR |
| 213622-90-3 | Phalluside 2 |
| 25757-58-8 | Phosphine oxide,aminohydroxyisothiocyanato- | CH3 N2 O2 P S |
| 4841-22-9 | P-CHLOROPHENOXYACETIC ACID METHYL ESTER | C9H9 Cl O3 |
| 14616-35-4 | Phosphenimidouschloride (8CI,9CI) | ClH N P |
| 25103-30-4 | Pyridinium, 1-[2-[(1-oxododecyl)amino]ethyl]-, O-isooctyl carbonodithioate (9CI) | C19 H33 N2 O . C9 H17 O S2 |
| 82010-83-1 | Polyvinylpyrrolidone-formaldehyde | (C6H9NO)x.xCH2O |
| 83144-65-4 | Porosin B |
| 36413-57-7 | Prostane | C20H40 |
| 101-74-6 | p-(p-anilinoanilino)phenol | C18H16 N2 O |
| 13464-19-2 | PHENYL CHLOROTHIOFORMATE | C7H5 Cl O S |
| 25756-93-8 | Phosphonohydrazidodithioicacid (8CI,9CI) | H5N2 P S2 |
| 4013-71-2 | PYRIDINE-2-CARBONYL AZIDE | C6H4 N4 O |
| 31622-87-4 | Poly[(dimethyliminio)-1,3-propanediylbromide (1:1)] | (C5H12 N)n . Br |
| 102207-40-9 | Piperidinium,1,1'-[1,4-phenylenebis(methylene)]bis[1-ethyl-, dibromide (9CI) | C22H38 N2 . 2 Br |
| 9003-95-6 | POLY(VINYL STEARATE) | C20 H38 O2 |
| 115967-80-1 | Poly[(1,3-dihydro-1,3-dioxo-2H-isoindole-5,2-diyl)-1,3-phenylene(1,3-dihydro-1,3-dioxo-2H-isoindole-2,5-diyl)carbonyl-1,3-phenylenecarbonyl](9CI) | (C30H14 N2 O6)n |
| 53808-91-6 | P-680 |
| 141930-80-5 | Pyrrolidine,1,1'-[(ethylsulfinyl)phosphinylidene]bis- (9CI) | C10H21 N2 O2 P S |
| 59154-64-2 | Poly[oxy(methyl-1,2-ethanediyl)], α-hydro-ω-hydroxy-, ether with -D-fructofuranosyl α-D-glucopyranoside, polymer with 1,3-diisocyanatomethylbenzene | (C12H22O11.C9H6N2O2.x(C3H6O)nH2O)x |
| 93841-32-8 | potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-4-sulphonate monohydrochloride | C8H9 N3 O3 S2 . Cl H . K |
| 112908-98-2 | Poly(oxy-1,2-ethanediyl),a-sulfo-w-[nonyl(2-propen-1-yl)phenoxy]-,ammonium salt (1:1) | (C2H4 O)n C18 H28 O4 S . H3 N |
| 102504-51-8 | Propanoic acid,3-[2-[3-(acetylamino)-2,4,6-triiodophenoxy]ethoxy]-2-methyl-, sodium salt (1:1) | C14H16 I3 N O5 . Na |
| 91079-57-1 | Plankton, marine, ext. |
| 71847-93-3 | Propanoic acid, 2,2-dimethyl-, 1,2-dihydro-2-oxo-3-pyridinyl ester (9CI) | C10H13 N O3 |
| 63797-09-1 | Probaphen |
| 25331-89-9 | Phosphorodichloridodithioicacid (8CI,9CI) | Cl2H P S2 |
| 126088-49-1 | Phenol, 2-(2-propenyl)-3-(1-propyl-3-piperidinyl)- | C17H25 N O |
| 31661-27-5 | propane-1,2,3-triyl trioctacosanoate | C87H170 O6 |
| 63906-06-9 | Pyridinium,1,1'-[[1,1'-biphenyl]-4,4'-diylbis(1-oxo-2,1-ethanediyl)]bis[3-(hydroxymethyl)-,dibromide (9CI) | C28H26 N2 O4 . 2 Br |
| 53663-72-2 | Propan Gel S |
| 27751-69-5 | Phosphorodifluoridoushydrazide (9CI) | F2H3 N2 P |
| 9033-76-5 | Poly(oxy-1,2-ethanediyl),R-sec-tetradecyl-ö- hydroxy- |
| 63653-20-3 | Proteinase, Agkistrodonacutus venom, Ac1 |
| 55609-84-2 | pannarin | C18H15 Cl O6 |
| 27104-55-8 | phenyl(quinolin-2-yl)methanol | C16H13 N O |
| 31319-52-5 | Palladate(4-),dichloro[[N,N'-(1-methyl-1,2-ethanediyl)bis[N-(carboxymethyl)glycinato-kN]](4-)]-, tetrahydrogen,(SP-4-3)- (9CI) | C11H14 Cl2 N2 O8 Pd . 4 H |
| 3689-73-4 | Penethamate | C22H31 N3 O4 S |
| 24582-52-3 | Phenylarsonous acid dimethyl ester | C8H11 As O2 |
| 25610-21-3 | POLY(DIETHYLENE GLYCOL SEBACATE)) | (C10H18O4.C4H10O3)x |
| 23984-17-0 | Pierisformosin B | C23H38 O7 |
| 15536-27-3 | Phosphonothioic acid,methyl-, S-butyl O-hexyl ester (8CI,9CI) | C11H25 O2 P S |
| 78005-05-7 | Pan-W-4 | C19H25 N2 O4 . I |
| 14616-64-9 | Phosphinesulfenothioicacid, 1,1-dihydroxy-, 1-oxide | H3O3 P S2 |
| 234446-39-0 | Phenol, 2(or4)-sec-triacontyl- | C36H66 O |
| 937-62-2 | P-TOLYL CHLOROFORMATE | C8H7 Cl O2 |
- About us - Payment - Contact us - Links - Help Center - Disclaimer
- SiteMap | Product SiteMap | New CAS | Cas Database | Article Data | Product Name | Chemical Catalog | Manufacturers | VIP Product | Suppliers
- ©2008 LookChem.com,License:ICP NO.lookchem:Zhejiang16009103 complaints:service@lookchem.com
- [Hangzhou]86-0571-87562588,87562578,87562573 Our Legal adviser: Lawyer