| 31719-34-3 | Phosphinic amide,N,N'-tetramethylenebis[P,P-bis(1-aziridinyl)-N-benzyl- (8CI) | C26H38 N6 O2 P2 |
| 3161-14-6 | Phenol,2,2'-thiobis[3,4,6-trichloro- | C12H4 Cl6 O2 S |
| 139261-90-8 | PHENYL-[1-(TOLUENE-4-SULFONYL)-1H-PYRROL-3-YL]-METHANONE | C18H15NO3S |
| 75880-28-3 | Propanol, [(1-methyl-1,2-ethanediyl)bis (oxy)]bis-, polymer with 1-isocyanato-2-[(4-isocyanatophenyl)methyl]benzene and 1,1'-methylenebis[4-isocyanatobenzene] | C39H40N4O8 |
| 37238-30-5 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy-, polymer with 1,3-diisocyanatomethylbenzene and 1,1'-methylenebis[4-isocyanatobenzene] | (C15H10N2O2·C9H6N2O2·(C3H6O)nH2O)x |
| 16201-63-1 | PHENYLCYCLOHEXANOL | C12H16 O |
| 9073-82-9 | Proteinase,Streptomyces rimosus |
| 101246-66-6 | PHENSERINE | C20H23 N3 O2 |
| 19220-93-0 | PENTAFLUOROPHENYL ACETATE | C8H3F5O2 |
| 10127-55-6 | phenanthrene-4,5-diol | C14H10 O2 |
| 202189-20-6 | Pyrrolidinium,1-[(pentafluorophenoxy)-1- pyrrolidinylmethylene]-,hexafluorophosphate- (1-) |
| 160274-96-4 | Peptide CHP 1 (chickenheterophil reduced) (9CI) | C196H321 N59 O49 S6 |
| 93892-69-4 | potassium 2-methylnaphthalenesulphonate | C11H10 O3 S . K |
| 84170-15-0 | Phenol, tetrachloro(pentachlorophenoxy)- |
| 88411-93-2 | Phenol,2,2'-methylenebis[3,4,6-trichloro-,mixt. with 2-propanol |
| 94135-10-1 | pentyl 4-methylsalicylate | C13H18 O3 |
| 28880-55-9 | Poly(oxy-1,2-ethanediyl), alpha,alpha′-((methyl-9- octadecenyliminio)di-2,1-ethanediyl)bis(omega-hydroxy-, chloride, (Z)- (EO 3-10) | (C2H4 O)n (C2 H4 O)n C23 H48 N O2 . Cl |
| 111537-26-9 | phosphoenolthiopyruvate | C3H5 O5 P S |
| 143178-24-9 | Poly[oxy[(azidomethyl)-1,2-ethanediyl]],a-hydro-w-hydroxy- | (C3H5 N3 O)n H2 O |
| 120396-83-0 | Phenylalanine,leucyl-3-[3-(2-aminoethenyl)-4-methoxyphenoxy]prolyl-, (3®2)-lactam | C29H36 N4 O5 |
| 146555-80-8 | Pyrrolo[4,3,2-de]quinolin-8(3H)-one,7-amino-4,5-dihydro-5-methyl-, conjugate acid (1:1) | C11H11 N3 O . H |
| 66594-31-8 | PYDRAUL50E |
| 9024-15-1 | Poly-(B-D-1,4-mannuronide)-lyase |
| 45294-11-9 | Polyethylene glycol octadecyl ether sulfuric acid | (C2H4 O)n C18 H38 O4 S |
| 71130-54-6 | PHENYL-N-(4-CYANOPHENYL)CARBAMATE | C14H10N2O2 |
| 16531-31-0 | p-Butoxy-N-[2-(diethylamino)ethyl]thiobenzamide | C17H28 N2 O S |
| 57567-85-8 | Ped-O-Bond 3 | C22H45NO4 |
| 3117-38-2 | phenoxy(phenyl)acetic acid | C14H12 O3 |
| 110905-37-8 | Phosphonic acid, (4-oxo-2-butenyl)-, diethyl ester, (E)- | C8H15 O4 P |
| 4442-11-9 | Piperidine,compounds,lithium salt | C5H10LiN |
| 24819-73-6 | Phosphinous azide,(1,2-dicarbadodecaborane(12)-1,2-diyl)bis- (9CI) | C2H12 B10 N6 P2 |
| 14500-94-8 | Phosphorodichloridothioicacid (7CI,8CI,9CI) | Cl2H O P S |
| 131132-77-9 | Pentanedioic acid,1,5-bis[[4-[(ethenyloxy)methyl]cyclohexyl]methyl] ester | C25H40 O6 |
| 2310-87-4 | phenyl hydrogen phenylphosphonate | C12H11 O3 P |
| 5743-97-5 | perhydrophenanthrene | C14H24 |
| 80503-46-4 | pyridoxal(5')diphospho(1)-glucose | C14H21 N O14 P2 . 2 Na |
| 33864-03-8 | Pyridine, 3-(5-(p-methoxyphenyl)-2-oxazolyl)- |
| 24274-35-9 | Phosphoric acid,(1E)-3-[[(b-D-glucopyranosyloxy)methyl]amino]-1-methyl-3-oxo-1-propenyldimethyl ester (9CI) | C13H24 N O11 P |
| 100684-34-2 | Proteinhydrolyzates, apricot-kernel |
| 12534-46-2 | PZT 5A |
| 21517-67-9 | Phosphoric acid, silver salt | Ag3O4P |
| 76152-13-1 | Phosphonic acid, (4-aminophenyl)-, potassium salt | C6H8 N O3 P . x K |
| 18538-32-4 | Phenarsazinous acid |
| 169062-76-4 | PANTA |
| 89797-03-5 | Pyridinium, 1,1'-[(1-amino-8-hydroxy-3,6-disulfo-2,7-naphthalenediyl)bis[azo(4-sulfo-3,1-phenylene) imino[6-[(4-chloro-3-sulfophenyl)amino]-1,3,5-triazine-4,2-diyl]]]bis[3-carboxy-, dihydroxide, hexasodium salt | C52H37 Cl2 N17 O23 S6 . 2 H O . 6 Na |
| 139075-02-8 | Proline-rich structural protein, brugia |
| 61792-09-4 | pentasodium pentahydrogen [[(phosphonatomethyl)imino]bis[ethane-2,1-diylnitrilobis(methylene)]]tetrakisphosphonate | C35H100N15Na5O135P4520*-35 |
| 8031-57-0 | Potassium hypochlorite | ClKO |
| 1302-66-5 | petalite | Al. 2 H2 O5 Si2 . Li |
| 25758-27-4 | Phosphorodiamidimidicchloride (8CI,9CI) | ClH5 N3 P |
| 28322-92-1 | pyridine, compound with sulphur trioxide | C5H5NO3S |
| 146555-79-5 | Pyrrolo[4,3,2-de]quinolin-8(1H)-one,7-amino-1-methyl- | C11H9 N3 O |
| 13445-56-2 | Pyrophosphorous acid |
| 130728-85-7 | Phosphinotellurothioicacid (9CI) | H3P S Te |
| 475-39-8 | Pyrrolo[4,3,2-de]quinolinium,1,3,4,5-tetrahydro- 5,5-dimethyl-6-(sulfooxy)-,inner salt |
| 95823-35-1 | pentaerythritol tetra(3-mercaptopropionate) reaction prods | C39H68O15S7 |
| 18390-48-2 | potassium 2-hydroxy-1-naphthoate | C11H8 O3 . K |
| 119008-27-4 | PER 142E |
| 284685-45-6 | Phosphinic acid,P,P-diethyl-, zinc salt (2:1) | C4H11 O2 P . 1/2 Zn |
| 2667-52-9 | Phosphorodithioic acid O,O-bis(1-methylethyl)S-[[(1-methylethyl)thio]methyl] ester | C10H23 O2 P S3 |
| 84604-04-6 | Polygonum aviculare, ext. |
| 24996-58-5 | Phenol,4-(dimethylamino)-3-methyl-5-(1-methylethyl)-, methylcarbamate (ester) (9CI) | C14H22 N2 O2 |
| 147637-61-4 | Poly(oxy-1,2-ethanediyl),a-hydro-w-hydroxy-, ether with1,3-bis(hydroxymethyl)-2-imidazolidinone (4:1) (9CI) | (C2H4 O)n (C2 H4 O)n (C2 H4 O)n (C2 H4 O)n C5 H10 N2 O5 |
| 81740-07-0 | Praeruptorin B | C24H26O7 |
| 84646-84-4 | Pyrrolidine, 1-((5-chloro-3a,12b-dihydrodibenzo(b,f)-1,3-dioxolo(4,5-d )oxepin-2-yl)methyl)-, hydrochloride | C20H20 Cl N O3 . Cl H |
| 146729-34-2 | Poly(oxy-1,2-ethanediyl),a-(3-carboxy-1-oxopropyl)-w-(pentadecyloxy)- | (C2H4 O)n C19 H36 O4 |
| 3070-25-5 | Phosphorothioic acid,O-(4-nitrophenyl) O,O-dipropyl ester | C12H18 N O5 P S |
| 56123-10-5 | Proteinase inhibitor (pineapple stem B-1 chain reduced) |
| 287734-11-6 | Poly(oxy-1,2-ethanediyl),a-(2-carboxybenzoyl)-w-(2-propen-1-yloxy)-, potassiumsalt (1:1) | (C2H4 O)n C11 H10 O4 . K |
| 25758-01-4 | Phosphorobromidochloridousacid (8CI,9CI) | BrCl H O P |
| 167277-84-1 | Phosphoric bromidediiodide (9CI) | BrI2 O P |
| 156765-35-4 | Phenanthro[1,2-c]furan-5a(3bH)-ol,7-ethenyl-4,5,6,7,8,9,9a,9b,10,11-decahydro-7,9b-dimethyl-,(3bR,5aR,7S,9aR,9bS)- (9CI) | C20H28 O2 |
| 13023-70-6 | Pentanamide, 5-amino- | C5H12N2O |
| 84788-08-9 | propyl 2,4-decadienoate | C13H22O2 |
| 2681-67-6 | Pregn-4-ene-3,11,20-trione,17-hydroxy-21-(sulfooxy)-, sodium salt (1:1) | C21H28 O8 S . Na |
| 52183-82-1 | PYRROLIDINE-2-CARBOXYLIC ACID METHYL ESTER | C6H11 N O2 |
| 28622-66-4 | PHENANTHRENE-1,2-DIHYDRODIOL | C14H12 O2 |
| 9031-91-8 | Phosphoglucosamine transacetylase |
| 106008-90-6 | Poloxamer monobenzoate | C7H6O2.(C3H6O.C2H4O)x |
| 22756-17-8 | Phosphorothioic acid,S,S'-methylene O,O,O',O'-tetraethyl ester | C9H22 O6 P2 S2 |
| 135813-46-6 | propan-2-yl 5-benzamido-2-chloro-benzoate | C17H16 Cl N O3 |
| 77963-82-7 | potassium diisononyl phosphate | C18H39 O4 P . K |
| 72230-97-8 | Poly(oxy-1,2-ethanediyl), .alpha.,.alpha.,.alpha.-(nitrilotri-2,1-ethanediyl)tris.omega.-hydroxy-, benzoate (salt) | C7H6O2.(C2H4O)n(C2H4O)n(C2H4O)nC6H15NO3 |
| 5428-64-8 | pentaquine phosphate | C18H30N3O5P |
| 25774-02-1 | PHENYLMALONIC ACID MONOBENZYL ESTER | C16H14 O4 |
| 84332-91-2 | phosphoric acid, anhydride with boric acid (1:3), zinc salt (1:3) | B3H6 O10 P . 3 Zn |
| 105844-41-5 | Proteinase inhibitor,PAI |
| 177571-06-1 | Picogreen | C34H42N5S+ |
| 110826-39-6 | Phenol, 4-(2-(dipropylamino)cyclopropyl)-, trans-(+-)- | C15H23 N O |
| 57700-94-4 | Piperidino(4-methoxyphenyl) ketone | C13H17NO2 |
| 26952-37-4 | p-(3-oxobutyl)phenyl acetate | C12H14 O3 |
| 67713-17-1 | Pentarex | C5H12N6O15 |
| 25758-74-1 | Phosphorotriselenoicacid (8CI,9CI) | H3O P Se3 |
| 24979-97-3 | POLYTETRAHYDROFURAN | C4 H8 O |
| 55483-00-6 | Pungenin | C14H18O8 |
| 108375-77-5 | PC 766B | C43H68 O12 |
| 39341-09-8 | Poly(oxy-1,2-ethanediyl), alpha,alpha-phosphinicobis(omega-(decyloxy)- |
| 79665-92-2 | POLYGLYCERYL-6 OLEATE | C36H82O20 |
| 14514-74-0 | Pyridinium, 1- (2-hydroxy[1,1:3,1-terphenyl]-5-yl)-2,4, 6-triphenyl-, perchlorate (salt) | C41H33ClNO5+ |
| 144468-71-3 | Poly(oxy-1,2-ethanediyl), a-[(2Z)-3-carboxy-1-oxo-2-propen-1-yl]-w-(4-nonylphenoxy)-, branched |