113721-87-2 Usage
Uses
Used in Research and Diagnostic Applications:
AMCA-NHS is used as a fluorescent labeling agent for lysyl residues in proteins. This allows researchers to track and visualize the proteins of interest in various assays and experiments, providing valuable insights into their structure, function, and interactions.
Used in Bioconjugation:
AMCA-NHS is also used in the process of bioconjugation, where it can be used to attach proteins to other molecules, such as nanoparticles or other biomolecules. This can enhance the properties of the attached molecules, such as their stability, solubility, or targeting capabilities.
Used in Drug Delivery Systems:
In the field of drug delivery, AMCA-NHS can be used to label drug molecules or drug delivery carriers, allowing for the tracking and visualization of their distribution and interactions within biological systems. This can help in optimizing drug delivery strategies and improving therapeutic outcomes.
Used in Analytical Techniques:
AMCA-NHS can be employed in various analytical techniques, such as fluorescence microscopy, flow cytometry, and fluorescence spectroscopy, to detect and quantify the presence of specific proteins or other biomolecules. This can be particularly useful in diagnostics, environmental monitoring, and quality control applications.
Check Digit Verification of cas no
The CAS Registry Mumber 113721-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,7,2 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 113721-87:
(8*1)+(7*1)+(6*3)+(5*7)+(4*2)+(3*1)+(2*8)+(1*7)=102
102 % 10 = 2
So 113721-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O6/c1-8-10-3-2-9(17)6-12(10)23-16(22)11(8)7-15(21)24-18-13(19)4-5-14(18)20/h2-3,6H,4-5,7,17H2,1H3