Uses

Used in Organic Synthesis:
3-Dimethylaminopropyl chloride hydrochloride is used as a reagent in organic synthesis for the preparation of quaternary ammonium salts. Its strong alkylating properties make it a valuable component in the synthesis process.
Used as a Catalyst:
In various chemical reactions, 3-Dimethylaminopropyl chloride hydrochloride serves as a catalyst to enhance the reaction rates and improve the overall efficiency of the process.
Used in Surfactant Production:
3-Dimethylaminopropyl chloride hydrochloride is utilized as a precursor in the production of surfactants, which are essential in industries such as detergents, cosmetics, and textiles for their emulsifying, wetting, and dispersing properties.
Used in Pharmaceutical Industry:
As a precursor, 3-Dimethylaminopropyl chloride hydrochloride is used in the pharmaceutical industry for the synthesis of various drugs. Its reactivity and ability to form quaternary ammonium salts make it a key component in drug development.
Used in Agrochemicals:
3-Dimethylaminopropyl chloride hydrochloride is also employed in the synthesis of agrochemicals, where its strong alkylating properties contribute to the development of effective pesticides and other agricultural chemicals.

Check Digit Verification of cas no

The CAS Registry Mumber 1281-00-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,8 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1281-00:
(6*1)+(5*2)+(4*8)+(3*1)+(2*0)+(1*0)=51
51 % 10 = 1
So 1281-00-1 is a valid CAS Registry Number.

InChI:InChI=1/C5H12ClN/c1-7(2)5-3-4-6/h3-5H2,1-2H3/p+1