Uses

Used in Pharmaceutical Industry:
6-Chloro-3-methoxy-2-methylpyridine is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and reactivity allow for the development of new drugs with improved efficacy and reduced side effects. It plays a crucial role in the production of medications for the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 6-chloro-3-methoxy-2-methylpyridine is utilized as an intermediate in the synthesis of various agrochemicals, including pesticides and herbicides. Its properties and reactivity contribute to the development of more effective and environmentally friendly agricultural products, helping to increase crop yields and protect plants from pests and diseases.
Used in Organic Synthesis:
6-Chloro-3-methoxy-2-methylpyridine is also used as a valuable building block in organic synthesis. Its unique structure and reactivity make it an ideal candidate for the synthesis of a wide range of organic compounds, including fine chemicals, dyes, and other specialty chemicals. Its versatility in chemical processes allows for the creation of new and innovative products with diverse applications.

Check Digit Verification of cas no

The CAS Registry Mumber 129692-13-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,9 and 2 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 129692-13:
(8*1)+(7*2)+(6*9)+(5*6)+(4*9)+(3*2)+(2*1)+(1*3)=153
153 % 10 = 3
So 129692-13-3 is a valid CAS Registry Number.

InChI:InChI=1/C7H8ClNO/c1-5-6(10-2)3-4-7(8)9-5/h3-4H,1-2H3