14018-90-7 Usage
Uses
Used in Pharmaceutical Industry:
Phenylguanidine carbonate salt is used as a reagent for the synthesis of polo-like kinase 1 inhibitors, which are essential in the development of targeted cancer therapies. Its role in creating these inhibitors is significant due to its ability to selectively target and inhibit the activity of polo-like kinase 1, a key enzyme involved in cell division and proliferation, which is often dysregulated in cancer cells.
Additionally, Phenylguanidine carbonate salt is used as a reagent in the synthesis of monosubstituted guanidines. These compounds have a wide range of applications in the pharmaceutical industry, including their use as building blocks for the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 14018-90-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,1 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 14018-90:
(7*1)+(6*4)+(5*0)+(4*1)+(3*8)+(2*9)+(1*0)=77
77 % 10 = 7
So 14018-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3.CH2O3/c8-7(9)10-6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H4,8,9,10);(H2,2,3,4)