Uses

Used in Pharmaceutical Industry:
2,3,5,6-Tetrafluorophenyloxy-acetic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to facilitate the creation of new drug molecules with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,5,6-tetrafluorophenyloxy-acetic acid serves as a precursor in the development of agrochemicals, contributing to the production of effective pesticides and other crop protection agents.
Used in Materials Science:
2,3,5,6-Tetrafluorophenyloxy-acetic acid is utilized in materials science for its potential to enhance the properties of various materials, such as improving their stability, reactivity, or other characteristics.
Used in Surface Chemistry:
2,3,5,6-TETRAFLUOROPHENYLOXY-ACETIC ACID finds applications in surface chemistry, where its unique structure can be employed to modify surfaces or create new surface-active materials for various technological and industrial uses.

Check Digit Verification of cas no

The CAS Registry Mumber 14742-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,7,4 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14742-39:
(7*1)+(6*4)+(5*7)+(4*4)+(3*2)+(2*3)+(1*9)=103
103 % 10 = 3
So 14742-39-3 is a valid CAS Registry Number.

InChI:InChI=1/C8H4F4O3/c9-3-1-4(10)7(12)8(6(3)11)15-2-5(13)14/h1H,2H2,(H,13,14)/p-1