352351-61-2 Usage
Uses
Used in Pharmaceutical Research and Development:
Fmoc-D-2,4-dichlorophenylalanine is used as a building block in the synthesis of peptides and proteins for the development of new pharmaceuticals. Its incorporation into peptide structures allows for the alteration of biological activity, potentially leading to the discovery of novel therapeutic agents.
Used in Peptide Synthesis:
In the field of peptide synthesis, Fmoc-D-2,4-dichlorophenylalanine is used as a specific structural component to create modified peptides. These modified peptides can exhibit different properties compared to their natural counterparts, which is crucial for understanding protein functions and developing new bioactive compounds.
Used in Solid-Phase Peptide Synthesis:
Fmoc-D-2,4-dichlorophenylalanine is employed as a key component in solid-phase peptide synthesis, a technique that simplifies the synthesis process and increases the yield of the desired peptide. Its stability and compatibility with the Fmoc strategy make it an ideal choice for this method.
Used in the Creation of Modified Peptides with Altered Properties:
Fmoc-D-2,4-dichlorophenylalanine is used to create modified peptides with altered physical, chemical, or biological properties. This modification can lead to peptides with improved stability, selectivity, or activity, which is essential for various research and pharmaceutical applications, including drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 352351-61-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,3,5 and 1 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 352351-61:
(8*3)+(7*5)+(6*2)+(5*3)+(4*5)+(3*1)+(2*6)+(1*1)=122
122 % 10 = 2
So 352351-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C24H19Cl2NO4/c25-15-10-9-14(21(26)12-15)11-22(23(28)29)27-24(30)31-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-10,12,20,22H,11,13H2,(H,27,30)(H,28,29)/t22-/m1/s1