Uses

Used in Pharmaceutical Industry:
H-HIS-TYR-OH is used as a pharmaceutical compound for its potential therapeutic applications. Given its composition of essential amino acids and the biological significance of the peptide bond, it may contribute to the development of drugs targeting various health conditions.
Used in Biochemistry Research:
In biochemistry, H-HIS-TYR-OH serves as a valuable research tool. Its structure allows scientists to study the interactions between amino acids, the formation of peptide bonds, and the role of hydroxyl groups in molecular biology.
Used in Peptide Research:
H-HIS-TYR-OH is utilized in peptide research to understand the properties and functions of peptides. Its specific amino acid sequence can provide insights into peptide synthesis, stability, and biological activity, which are crucial for the design of peptide-based drugs and therapeutic agents.

Check Digit Verification of cas no

The CAS Registry Mumber 35979-00-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,9,7 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35979-00:
(7*3)+(6*5)+(5*9)+(4*7)+(3*9)+(2*0)+(1*0)=151
151 % 10 = 1
So 35979-00-1 is a valid CAS Registry Number.

InChI:InChI=1/C15H18N4O4/c16-12(6-10-7-17-8-18-10)14(21)19-13(15(22)23)5-9-1-3-11(20)4-2-9/h1-4,7-8,12-13,20H,5-6,16H2,(H,17,18)(H,19,21)(H,22,23)