40719-58-2 Usage
Uses
Used in Pharmaceutical Industry:
H-LYS-GLY-OH HCL is used as a pharmaceutical compound for its potential role in drug development. The combination of lysine and glycine in H-LYS-GLY-OH HCL may contribute to the creation of new therapeutic agents, leveraging their amino acid properties for targeted treatments.
Used in Biotechnological Applications:
In the biotechnology field, H-LYS-GLY-OH HCL is utilized as a component in various biotechnological processes. Its unique structure and properties may facilitate advancements in areas such as protein engineering, enzyme production, and the development of novel biocatalysts.
Used in Research and Development:
H-LYS-GLY-OH HCL serves as a valuable research tool in the fields of biochemistry and medicine. Its potential applications in understanding protein synthesis, enzyme function, and the development of new therapeutic strategies make it an important compound for scientific investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 40719-58-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,1 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40719-58:
(7*4)+(6*0)+(5*7)+(4*1)+(3*9)+(2*5)+(1*8)=112
112 % 10 = 2
So 40719-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H17N3O3.ClH/c9-4-2-1-3-6(10)8(14)11-5-7(12)13;/h6H,1-5,9-10H2,(H,11,14)(H,12,13);1H
