71989-93-0 Usage
Uses
Used in Organic Synthesis:
2,4,6-Trihydroxybenzoic acid monohydrate is used as a key intermediate in organic synthesis for the production of various derivatives and complex organic molecules. Its unique structure allows for multiple points of functionalization, making it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4,6-trihydroxybenzoic acid monohydrate is used as a starting material for the synthesis of drugs and drug candidates. Its versatility in chemical reactions enables the development of new therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Agrochemical Industry:
2,4,6-Trihydroxybenzoic acid monohydrate is utilized as a raw material in the agrochemical industry for the production of pesticides, herbicides, and other crop protection agents. Its chemical properties make it suitable for the development of effective and environmentally friendly agrochemical products.
Used in Dyestuff Industry:
In the dyestuff industry, 2,4,6-trihydroxybenzoic acid monohydrate is employed as an intermediate for the synthesis of various dyes and pigments. Its ability to form colored compounds through chemical reactions contributes to the creation of a wide range of colorants used in textiles, plastics, and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 71989-93-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,8 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71989-93:
(7*7)+(6*1)+(5*9)+(4*8)+(3*9)+(2*9)+(1*3)=180
180 % 10 = 0
So 71989-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12)/p-1