Uses

Used in Pharmaceutical Industry:
3-cyclopropylpyrazole-4-carboxylic acid is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activities, including anti-inflammatory and antimicrobial properties. Its role in the development of new drugs makes it a crucial component in medicinal chemistry.
Used in Agrochemical Industry:
3-cyclopropylpyrazole-4-carboxylic acid is used as an intermediate in the synthesis of agrochemicals, contributing to the development of products that can enhance crop protection and improve agricultural yields.
Used in Medicinal Chemistry Research:
3-cyclopropylpyrazole-4-carboxylic acid is used as a valuable compound in the field of medicinal chemistry, where it is studied for its potential applications in the treatment of various diseases, showcasing its versatility and importance in drug discovery and development.

Check Digit Verification of cas no

The CAS Registry Mumber 870704-26-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,0 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 870704-26:
(8*8)+(7*7)+(6*0)+(5*7)+(4*0)+(3*4)+(2*2)+(1*6)=170
170 % 10 = 0
So 870704-26-0 is a valid CAS Registry Number.

InChI:InChI=1/C7H8N2O2/c10-7(11)5-3-8-9-6(5)4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11)