871332-76-2 Usage
Uses
Used in Pharmaceutical Industry:
4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID is used as a reagent for the preparation of various pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of complex organic molecules, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID serves as a reagent in the synthesis of agrochemicals. Its properties enable the creation of compounds that can be used in the development of pesticides, herbicides, and other agricultural chemicals to improve crop protection and yield.
Used as a Building Block in Organic Synthesis:
4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID is utilized as a building block in the production of complex organic molecules. Its structural features make it a valuable component in the synthesis of a wide range of organic compounds, expanding the possibilities for chemical research and development.
Used in Suzuki-Miyaura Cross-Coupling Reaction:
As a reagent in the Suzuki-Miyaura cross-coupling reaction, 4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID plays a crucial role in the formation of carbon-carbon bonds. This reaction is widely used in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and advanced materials.
Used in Material Science Research:
4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID has been studied for its potential application in the development of novel materials. Its unique properties and reactivity make it a promising candidate for the creation of new materials with specific characteristics, such as improved mechanical, electrical, or optical properties.
Used in Pharmaceutical Compound Development:
In the field of pharmaceutical compound development, 4-CHLORO-3-(DIMETHYLAMINOCARBONYL)PHENYLBORONIC ACID is employed for its potential to contribute to the discovery and synthesis of new drug candidates. Its versatile chemical structure allows for the exploration of various therapeutic targets and the development of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-76-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 871332-76:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*7)+(1*6)=172
172 % 10 = 2
So 871332-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BClNO3/c1-12(2)9(13)7-5-6(10(14)15)3-4-8(7)11/h3-5,14-15H,1-2H3
