Uses

Used in Pharmaceutical Industry:
6-ChloroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and potential biological activities make it a promising candidate for the development of new drugs, particularly in the treatment of various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 6-chloroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid serves as a vital building block for the creation of novel agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control, crop protection, and other agricultural applications, contributing to increased crop yields and improved food security.
Used in Organic Synthesis:
6-ChloroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid is employed as a versatile intermediate in organic synthesis. Its presence in a wide range of chemical reactions allows for the creation of diverse compounds with various applications across different industries, showcasing its adaptability and importance in chemical research and development.
Used in Drug Discovery:
6-ChloroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid plays a significant role in drug discovery, where its unique structure and potential biological activities are harnessed to identify and develop new therapeutic agents. Its contribution to the discovery of novel drugs is invaluable, as it can lead to the creation of more effective treatments for a variety of medical conditions.

Check Digit Verification of cas no

The CAS Registry Mumber 876379-75-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,3,7 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 876379-75:
(8*8)+(7*7)+(6*6)+(5*3)+(4*7)+(3*9)+(2*7)+(1*5)=238
238 % 10 = 8
So 876379-75-8 is a valid CAS Registry Number.

InChI:InChI=1/C8H5ClN2O2/c9-5-1-2-6-3-7(8(12)13)10-11(6)4-5/h1-4H,(H,12,13)