Uses

Used in Chemical Synthesis:
1,2,3-Trifluoro-5-methoxy-4-nitrobenzene is used as a synthetic intermediate for the production of other chemicals. Its strong electron-withdrawing properties make it a valuable building block in organic synthesis, contributing to the creation of a variety of chemical compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 1,2,3-Trifluoro-5-methoxy-4-nitrobenzene is used as a key component in the development of new drugs. Its unique chemical structure allows for the design and synthesis of potential therapeutic agents with specific properties and functions.
Used in Agrochemical Production:
1,2,3-Trifluoro-5-methoxy-4-nitrobenzene is also utilized in the agrochemical sector for the development of new pesticides and other agricultural chemicals. Its electron-withdrawing properties can enhance the effectiveness and selectivity of these compounds in controlling pests and diseases.
Used in Material Science:
In the field of material science, 1,2,3-Trifluoro-5-methoxy-4-nitrobenzene is employed in the development of new materials with specific properties. Its unique chemical structure can contribute to the creation of materials with improved performance characteristics, such as enhanced stability, reactivity, or selectivity.

Check Digit Verification of cas no

The CAS Registry Mumber 925890-13-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,5,8,9 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 925890-13:
(8*9)+(7*2)+(6*5)+(5*8)+(4*9)+(3*0)+(2*1)+(1*3)=197
197 % 10 = 7
So 925890-13-7 is a valid CAS Registry Number.

InChI:InChI=1/C7H4F3NO3/c1-14-4-2-3(8)5(9)6(10)7(4)11(12)13/h2H,1H3