The [1,1'-Biphenyl]-4-carboximidamide,4'-hydroxy-, with the CAS registry number 149507-28-8, has the molecular formula C₁₃H₁₂N₂O. In addition, its molecular weight is 212.2472. Its systematic name is called 4-(4-hydroxyphenyl)benzamidine.

Physical properties of [1,1'-Biphenyl]-4-carboximidamide,4'-hydroxy-: (1)ACD/LogP: 2.18; (2)ACD/LogD (pH 5.5): 0.176; (3)ACD/LogD (pH 7.4): 0.174; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 3.638; (7)ACD/KOC (pH 7.4): 3.616; (8)#H bond acceptors: 3; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.624; (12)Molar Refractivity: 62.039 cm³; (13)Molar Volume: 175.699 cm³; (14)Surface Tension: 49.771 dyne/cm; (15)Density: 1.208 g/cm³; (16)Flash Point: 187.026 °C; (17)Enthalpy of Vaporization: 65.929 kJ/mol; (18)Boiling Point: 385.636 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(ccc1c2ccc(cc2)O)C(=N)N
(2)InChI: InChI=1/C13H12N2O/c14-13(15)11-3-1-9(2-4-11)10-5-7-12(16)8-6-10/h1-8,16H,(H3,14,15)
(3)InChIKey: LYXGPCCFLYQXMQ-UHFFFAOYAH