This chemical is called (3-¹⁴C)fluoranthene, and it's also named as Fluoranthene-3-14C. With the molecular formula of C₁₅¹⁴CH₁₀, its molecular weight is 204.27. The CAS registry number of this chemical is 134459-04-4.

Other characteristics of the (3-14C)fluoranthene can be summarised as followings: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Index of Refraction: 1.851; (5)Molar Refractivity: 72.46 cm³; (6)Molar Volume: 161.9 cm³; (7)Polarizability: 28.72×10^-24cm³; (8)Surface Tension: 59.4 dyne/cm; (9)Density: 1.248 g/cm³.

You can still convert the following datas into molecular structure: 
1.SMILES: c1ccc-2c(c1)-c3cccc4c3c2ccc4
2.InChI: InChI=1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H/i5+2
3.InChIKey: GVEPBJHOBDJJJI-RHRFEJLCEX