The (R)-3-Amino-3-(3-methoxyphenyl)propanoic acid, its cas register number is 765895-65-6. It also can be called as Benzenepropanoic acid, b-amino-3-methoxy-, (bR)- and the Systematic name about this chemical is (3R)-3-amino-3-(3-methoxyphenyl)propanoic acid. It belongs to the following product categories, such as Methoxy, 3-Amino-3-phenylpropanoic Acid Analogs, API intermediates and so on.

Physical properties about (R)-3-Amino-3-(3-methoxyphenyl)propanoic acid are: (1)#H bond acceptors: 4; (2)#H bond donors: 3; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 38.77Ų; (5)Index of Refraction: 1.558; (6)Molar Refractivity: 52.21 cm³; (7)Molar Volume: 161.8 cm³; (8)Polarizability: 20.7x10^-24cm³; (9)Surface Tension: 49.7 dyne/cm; (10)Enthalpy of Vaporization: 62.77 kJ/mol; (11)Vapour Pressure: 1.66E-05 mmHg at 25°C

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C[C@H](c1cc(OC)ccc1)N
(2)InChI: InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1
(3)InChIKey: FGMPGCPZEOXEES-SECBINFHBH
(4)Std. InChI: InChI=1S/C10H13NO3/c1-14-8-4-2-3-7(5-8)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1
(5)Std. InChIKey: FGMPGCPZEOXEES-SECBINFHSA-N