The (S)-1-(2-Methoxyphenyl)ethylamine with the cas number 68285-24-5 is also called Benzenemethanamine,2-methoxy-a-methyl-, (S)-. Its molecular formula is C₉H₁₃NO. The Product Category is Amino Acid Derivatives. This chemical is sensitive to air.

The properties of the chemical are: (1)ACD/LogP: 1.35; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 12.47 Å²; (7)Index of Refraction: 1.522; (8)Molar Refractivity: 46.01 cm³; (9)Molar Volume: 150.6 cm³; (10)Polarizability: 18.24×10^-24cm³; (11)Surface Tension: 35.6 dyne/cm; (12)Enthalpy of Vaporization: 48.11 kJ/mol; (13)Vapour Pressure: 0.031 mmHg at 25°C.

Preparation: This chemical can be prepared by 1-(2-methoxy-phenyl)-ethanone. This reaction needs reagent ammonium acetate, sodium cyanoborohydride and solvent methanol at Ambient temperature. The reaction time is 96 hours. The yield is 82%.

Uses: This chemical can react with oxoacetic acid methyl ester, to product methyl (1-o-methoxyphenylethylimino)acetate. This reaction needs reagent 4 Angstroem molecular sieves and solvent CH₂Cl₂ at temperature of 20 °C. The reaction time is 1.0 hours. The yield is 45%. This reaction is Condensation.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c1ccccc1[C@@H](N)C)C
(2)InChI: InChI=1/C7H6INO2/c1-11-7(10)5-3-2-4-9-6(5)8/h2-4H,1H3 
(3)InChIKey: VENQOHAPVLVQKV-ZETCQYMHBT