The (S)-Pent-3-yne-2-ol, with the CAS registry number 90242-65-2, is also known as 3-Pentyn-2-ol, (2S)-. This chemical's molecular formula is C₅H₈O and molecular weight is 84.12. Its systematic name is called (2S)-pent-3-yn-2-ol.

Physical properties of (S)-Pent-3-yne-2-ol: (1)ACD/LogP: 0.99; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 43; (8)ACD/KOC (pH 7.4): 43; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.448; (13)Molar Refractivity: 24.712 cm³; (14)Molar Volume: 92.257 cm³; (15)Surface Tension: 34.349 dyne/cm; (16)Density: 0.912 g/cm³; (17)Flash Point: 56.914 °C; (18)Enthalpy of Vaporization: 44.977 kJ/mol; (19)Boiling Point: 149.195 °C at 760 mmHg; (20)Vapour Pressure: 1.561 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: C(#C[C@@H](O)C)C
(2)InChI: InChI=1/C5H8O/c1-3-4-5(2)6/h5-6H,1-2H3/t5-/m0/s1
(3)InChIKey: HJFRLXPEVRXBQZ-YFKPBYRVBJ