The 1-Benzyl-4-hydroxy-4-piperidinecarboxylic acid, with the CAS registry number 59119-18-5, is also known as 4-Piperidinecarboxylic acid, 4-hydroxy-1-(phenylmethyl)-. This chemical's molecular formula is C₁₃H₁₇NO₃ and molecular weight is 235.28. Its systematic name is called 1-benzyl-4-hydroxypiperidine-4-carboxylic acid.

Physical properties of 1-Benzyl-4-hydroxy-4-piperidinecarboxylic acid: (1)ACD/LogP: 0.14; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 4; (9)Index of Refraction: 1.607; (10)Molar Refractivity: 63.39 cm³; (11)Molar Volume: 183.4 cm³; (12)Surface Tension: 62.7 dyne/cm; (13)Density: 1.282 g/cm³; (14)Flash Point: 212.9 °C; (15)Enthalpy of Vaporization: 72.05 kJ/mol; (16)Boiling Point: 428.3 °C at 760 mmHg; (17)Vapour Pressure: 4.23E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OC(=O)C2(O)CCN(Cc1ccccc1)CC2
(2)InChI: InChI=1/C13H17NO3/c15-12(16)13(17)6-8-14(9-7-13)10-11-4-2-1-3-5-11/h1-5,17H,6-10H2,(H,15,16)
(3)InChIKey: AFPNLFVPVQRYFL-UHFFFAOYAG