The 1-Methylbiguanide hydrochloride, with the CAS registry number 1674-62-0, is also known as N-Methylimidodicarbonimidic diamide monohydrochloride. This chemical's molecular formula is C₃H₁₀ClN₅ and molecular weight is 151.598. Its IUPAC name is called 1-(diaminomethylidene)-2-methylguanidine hydrochloride. This chemical's classification code is Drug / Therapeutic Agent.

Physical properties of 1-Methylbiguanide hydrochloride: (1)ACD/LogP: -1.79; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -4; (4)ACD/LogD (pH 7.4): -4; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 6; (11)#Freely Rotating Bonds: 1; (12)Flash Point: 89.9 °C; (13)Enthalpy of Vaporization: 46.15 kJ/mol; (14)Boiling Point: 225 °C at 760 mmHg; (15)Vapour Pressure: 0.0885 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN=C(N)N=C(N)N.Cl
(2)InChI: InChI=1S/C3H9N5.ClH/c1-7-3(6)8-2(4)5;/h1H3,(H6,4,5,6,7,8);1H
(3)InChIKey: AAYCPBAOUJRPIC-UHFFFAOYSA-N

The toxicity data is as follows: