The 1H-Indene-1,2(3H)-dione,6-methoxy-, 2-oxime, with the CAS registry number 24077-98-3, is also known as NSC338226. This chemical's molecular formula is C₁₀H₉NO₃ and molecular weight is 191.18336. Its IUPAC name is called 2-hydroxyimino-6-methoxy-3H-inden-1-one.

Physical properties of 1H-Indene-1,2(3H)-dione,6-methoxy-, 2-oxime: (1)ACD/LogP: 0.67; (2)ACD/LogD (pH 5.5): 0.67; (3)ACD/LogD (pH 7.4): 0.5; (4)ACD/BCF (pH 5.5): 1.89; (5)ACD/BCF (pH 7.4): 1.29; (6)ACD/KOC (pH 5.5): 54.78; (7)ACD/KOC (pH 7.4): 37.33; (8)#H bond acceptors: 4; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.617; (12)Molar Refractivity: 49.49 cm³; (13)Molar Volume: 141.4 cm³; (14)Surface Tension: 48.6 dyne/cm; (15)Density: 1.35 g/cm³; (16)Flash Point: 193.9 °C; (17)Enthalpy of Vaporization: 68.28 kJ/mol; (18)Boiling Point: 397.1 °C at 760 mmHg; (19)Vapour Pressure: 5.12E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC2=C(CC(=NO)C2=O)C=C1
(2)InChI: InChI=1S/C10H9NO3/c1-14-7-3-2-6-4-9(11-13)10(12)8(6)5-7/h2-3,5,13H,4H2,1H3
(3)InChIKey: BNMBBZNFBBNMDD-UHFFFAOYSA-N