The 1H-Indole-1-methanamine,N,N-dimethyl-, with the CAS registry number 5379-79-3, is also known as Indol-1-ylmethyl-dimethyl-amine. This chemical's molecular formula is C₁₁H₁₄N₂ and molecular weight is 174.2423. Its systematic name is called 1-(1H-indol-1-yl)-N,N-dimethylmethanamine.

Physical properties of 1H-Indole-1-methanamine,N,N-dimethyl-: (1)ACD/LogP: 2.31; (2)ACD/LogD (pH 5.5): -0.58; (3)ACD/LogD (pH 7.4): 0.9; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1.3; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 16.73; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.559; (11)Molar Refractivity: 55.68 cm³; (12)Molar Volume: 172.4 cm³; (13)Surface Tension: 36.1 dyne/cm; (14)Density: 1.01 g/cm³; (15)Flash Point: 121 °C; (16)Enthalpy of Vaporization: 51.5 kJ/mol; (17)Boiling Point: 276.5 °C at 760 mmHg; (18)Vapour Pressure: 0.00478 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cccc2c1ccn2CN(C)C
(2)InChI: InChI=1/C11H14N2/c1-12(2)9-13-8-7-10-5-3-4-6-11(10)13/h3-8H,9H2,1-2H3
(3)InChIKey: YIMPWIJIKJBRDM-UHFFFAOYAN