The CAS registry number of 2,2,2-Nitrilotrisethanol acetate is 14806-72-5. This chemical is also known as Acetic acid,triethanolamine salt. Its EINECS registry number is 238-874-2. This chemical's molecular formula is C₈H₁₉NO₅ and molecular weight is 209.24016. Its systematic name is called 2,2',2''-nitrilotriethanol acetate (1:1).

Physical properties of 2,2,2-Nitrilotrisethanol acetate are: (1)ACD/LogP: -1.11; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.39; (4)ACD/LogD (pH 7.4): -1.69; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1.57; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 9; (12)Flash Point: 185 °C; (13)Enthalpy of Vaporization: 67.02 kJ/mol; (14)Boiling Point: 335.4 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C.OCCN(CCO)CCO
(2)InChI: InChI=1/C6H15NO3.C2H4O2/c8-4-1-7(2-5-9)3-6-10;1-2(3)4/h8-10H,1-6H2;1H3,(H,3,4)
(3)InChIKey: UPCXAARSWVHVLY-UHFFFAOYAW