The 2-Amino-4-iodopyrimidine, with the CAS registry number 815610-16-3, is also known as 2-Pyrimidinamine, 4-iodo-. This chemical's molecular formula is C₄H₄IN₃ and molecular weight is 220.997. Its systematic name is called 4-Iodopyrimidin-2-amine.

Physical properties of 2-Amino-4-iodopyrimidine: (1)ACD/LogP: 0.81; (2)ACD/LogD (pH 5.5): 0.81; (3)ACD/LogD (pH 7.4): 0.81; (4)ACD/BCF (pH 5.5): 2.44; (5)ACD/BCF (pH 7.4): 2.44; (6)ACD/KOC (pH 5.5): 65.83; (7)ACD/KOC (pH 7.4): 65.85; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)Index of Refraction: 1.719; (11)Molar Refractivity: 39.57 cm³; (12)Molar Volume: 100.2 cm³; (13)Surface Tension: 77 dyne/cm; (14)Density: 2.204 g/cm³; (15)Flash Point: 174.5 °C; (16)Enthalpy of Vaporization: 61.11 kJ/mol; (17)Boiling Point: 364.9 °C at 760 mmHg; (18)Vapour Pressure: 1.63E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cnc(nc1I)N
(2)InChI: InChI=1/C4H4IN3/c5-3-1-2-7-4(6)8-3/h1-2H,(H2,6,7,8)
(3)InChIKey: YTFBUSIUBSVISR-UHFFFAOYAJ