The 9H-Fluorene, 2-bromo-9,9-dibutyl- has the CAS registry number 88223-35-2. This chemical's molecular formula is C₂₁H₂₅Br and molecular weight is 357.33. What's more, its systematic name is 2-bromo-9,9-dibutyl-9H-fluorene. 

Physical properties of 9H-Fluorene, 2-bromo-9,9-dibutyl- are: (1)ACD/LogP: 9.71; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 9; (4)ACD/LogD (pH 7.4): 9; (5)ACD/BCF (pH 5.5): 1000000; (6)ACD/BCF (pH 7.4): 1000000; (7)ACD/KOC (pH 5.5): 2280564; (8)ACD/KOC (pH 7.4): 2280564; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 6; (12)Index of Refraction: 1.562; (13)Molar Refractivity: 98.576 cm³; (14)Molar Volume: 304.119 cm³; (15)Polarizability: 39.079×10^-24cm³; (16)Surface Tension: 40.886 dyne/cm; (17)Density: 1.175 g/cm³; (18)Flash Point: 207.715 °C; (19)Enthalpy of Vaporization: 66.406 kJ/mol; (20)Boiling Point: 434.589 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc2ccc3c1ccccc1C(CCCC)(CCCC)c3c2
(2)Std. InChI: InChI=1S/C21H25Br/c1-3-5-13-21(14-6-4-2)19-10-8-7-9-17(19)18-12-11-16(22)15-20(18)21/h7-12,15H,3-6,13-14H2,1-2H3
(3)Std. InChIKey: AVCNDQUBVOMMSL-UHFFFAOYSA-N