The 2-Imidazolidinone,1-(4-methoxyphenyl)-, with the CAS registry number 62868-39-7, is also known as 1-(4-Methoxyphenyl)-2-imidazolidinone. This chemical's molecular formula is C₁₀H₁₂N₂O₂ and molecular weight is 192.21. What's more, its systematic name is 1-(4-methoxyphenyl)imidazolidin-2-one. 

Physical properties of 2-Imidazolidinone,1-(4-methoxyphenyl)- are: (1)ACD/LogP: 0.41; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.4; (4)ACD/LogD (pH 7.4): 0.4; (5)ACD/BCF (pH 5.5): 1.2; (6)ACD/BCF (pH 7.4): 1.2; (7)ACD/KOC (pH 5.5): 39.54; (8)ACD/KOC (pH 7.4): 39.54; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 32.78 Å²; (13)Index of Refraction: 1.561; (14)Molar Refractivity: 52 cm³; (15)Molar Volume: 160.4 cm³; (16)Polarizability: 20.61×10^-24cm³; (17)Surface Tension: 43.7 dyne/cm; (18)Density: 1.197 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C2NCCN2c1ccc(OC)cc1
(2)InChI: InChI=1S/C10H12N2O2/c1-14-9-4-2-8(3-5-9)12-7-6-11-10(12)13/h2-5H,6-7H2,1H3,(H,11,13)
(3)InChIKey: FNWSPWKYYZASIN-UHFFFAOYSA-N