The CAS register number of 2-Methylpyrrolo[2,1-f][1,2,4]triazin-4(1H)-one is 1150617-73-4. It also can be called as Pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 2-methyl- and the systematic name about this chemical is 2-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. The molecular formula about this chemical is C₇H₇N₃O and the molecular weight is 149.15.

Physical properties about 2-Methylpyrrolo[2,1-f][1,2,4]triazin-4(1H)-one are: (1)ACD/LogP: 0.41; (2)ACD/LogD (pH 5.5): 0.406; (3)ACD/LogD (pH 7.4): 0.342; (4)ACD/BCF (pH 5.5): 1.197; (5)ACD/BCF (pH 7.4): 1.035; (6)ACD/KOC (pH 5.5): 39.559; (7)ACD/KOC (pH 7.4): 34.198; (8)#H bond acceptors: 4; (9)#H bond donors: 1; (10)Polar Surface Area: 46.39Ų; (11)Index of Refraction: 1.699; (12)Molar Refractivity: 40.434 cm³; (13)Molar Volume: 104.717 cm³; (14)Polarizability: 16.029x10^-24cm³; (15)Surface Tension: 56.277 dyne/cm.

You can still convert the following datas into molecular structure:
(1)SMILES: Cc1[nH]c(=O)c2cccn2n1
(2)InChI: InChI=1/C7H7N3O/c1-5-8-7(11)6-3-2-4-10(6)9-5/h2-4H,1H3,(H,8,9,11)
(3)InChIKey: KYLCRQWYTHFOLK-UHFFFAOYAL
(4)Std. InChI: InChI=1S/C7H7N3O/c1-5-8-7(11)6-3-2-4-10(6)9-5/h2-4H,1H3,(H,8,9,11)
(5)Std. InChIKey: KYLCRQWYTHFOLK-UHFFFAOYSA-N