The CAS register number of 3(2H)-Pyridazinone,6-hydroxy-, potassium salt (1:1) is 28382-15-2. It also can be called as Maleic hydrazidepotassium salt and the IUPAC name about this chemical is potassium 1,2-dihydropyridazine-3,6-dione. The molecular formula about this chemical is C₄H₄KN₂O₂ and the molecular weight is 151.18506.

Physical properties about 3(2H)-Pyridazinone,6-hydroxy-, potassium salt (1:1) are: (1)ACD/LogP: -0.84; (2)ACD/LogD (pH 5.5): -0.84; (3)ACD/LogD (pH 7.4): -0.85; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 8.32; (7)ACD/KOC (pH 7.4): 8.12; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)Polar Surface Area: 40.62 Å²; (11)Heavy Atom Count: 9; (12)Formal Charge: 1; (13)Complexity: 143; (14)Covalently-Bonded Unit Count: 2.

You can still convert the following datas into molecular structure:
(1)SMILES: [K+].O=C1\C=C/C(=O)NN1
(2)InChI: InChI=1/C4H4N2O2.K/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+1
(3)InChIKey: ONFPEXMNTHPYGN-UHFFFAOYAU
(4)Std. InChI: InChI=1S/C4H4N2O2.K/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+1
(5)Std. InChIKey: ONFPEXMNTHPYGN-UHFFFAOYSA-N

The toxicity data are as follows: