The CAS register number of 3-Amino-2,4-dimethylpyridine is 1073-21-8. It also can be called as 3-Pyridinamine,2,4-dimethyl- and the IUPAC name about this chemical is 2,4-dimethylpyridin-3-amine. The molecular formula about this chemical is C₇H₁₀N₂ and the molecular weight is 122.17. It belongs to the following product categories, such as Heterocyclic Compound; Amines; Pyridines and so on.

Physical properties about 3-Amino-2,4-dimethylpyridine are: (1)ACD/LogP: 0.29; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 2; (5)ACD/KOC (pH 7.4): 29; (6)#H bond acceptors: 2; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 38.91Ų; (10)Index of Refraction: 1.564; (11)Molar Refractivity: 38.23 cm³; (12)Molar Volume: 117.488 cm³; (13)Polarizability: 15.156x10^-24cm³; (14)Surface Tension: 43.973 dyne/cm; (15)Flash Point: 132.153 °C; (16)Enthalpy of Vaporization: 49.319 kJ/mol; (17)Boiling Point: 255.708 °C at 760 mmHg; (18)Vapour Pressure: 0.016 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Cc1ccnc(c1N)C
(2)InChI: InChI=1/C7H10N2/c1-5-3-4-9-6(2)7(5)8/h3-4H,8H2,1-2H3
(3)InChIKey: FSYHJEBPLDNXAM-UHFFFAOYAA
(4)Std. InChI: InChI=1S/C7H10N2/c1-5-3-4-9-6(2)7(5)8/h3-4H,8H2,1-2H3
(5)Std. InChIKey: FSYHJEBPLDNXAM-UHFFFAOYSA-N