The 3-Pyridinecarboxylicacid, 6-amino-, hydrazide, with the CAS registry number 42596-56-5, is also known as 6-Amino-nicotinohydrazide. It belongs to the product category of Pharmacetical. This chemical's molecular formula is C₆H₈N₄O and molecular weight is 152.1539. What's more, its systematic name is called 6-Aminopyridine-3-carbohydrazide.

Physical properties about 3-Pyridinecarboxylicacid, 6-amino-, hydrazide are: (1)ACD/LogP: -1.07; (2)#of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -1.16; (4)ACD/LogD (pH 7.4): -1.07; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 5.09; (8)ACD/KOC (pH 7.4): 6.22; (9)#H bond acceptors: 5; (10)#H bond donors: 5; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 39.68 Å²; (13)Index of Refraction: 1.651; (14)Molar Refractivity: 41.1 cm³; (15)Molar Volume: 112.4 cm³; (16)Polarizability: 16.29×10^-24 cm³; (17)Surface Tension: 73.8 dyne/cm; (18)Density: 1.352 g/cm³; (19)Melting Point: 228-232 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(c1cnc(N)cc1)NN
(2) InChI: InChI=1/C6H8N4O/c7-5-2-1-4(3-9-5)6(11)10-8/h1-3H,8H2,(H2,7,9)(H,10,11)
(3) InChIKey: MUTYGKWOSMNYBG-UHFFFAOYAU