The 3-Pyridinemethanol,6-methoxy-2-methyl-, with the CAS registry number 32383-10-1, is also known as 5-Cyanomethyl-2-methoxy-6-methylpyridine. This chemical's molecular formula is C₉H₁₀N₂O and molecular weight is 162.19. Its systematic name is called (6-methoxy-2-methylpyridin-3-yl)acetonitrile.

Physical properties of 3-Pyridinemethanol,6-methoxy-2-methyl-: (1)ACD/LogP: 1.01; (2)ACD/LogD (pH 5.5): 1.01; (3)ACD/LogD (pH 7.4): 1.01; (4)ACD/BCF (pH 5.5): 3.46; (5)ACD/BCF (pH 7.4): 3.47; (6)ACD/KOC (pH 5.5): 84.58; (7)ACD/KOC (pH 7.4): 84.88; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.519; (11)Molar Refractivity: 45.31 cm³; (12)Molar Volume: 149.1 cm³; (13)Surface Tension: 42.4 dyne/cm; (14)Density: 1.087 g/cm³; (15)Flash Point: 127.7 °C; (16)Enthalpy of Vaporization: 52.68 kJ/mol; (17)Boiling Point: 287.6 °C at 760 mmHg; (18)Vapour Pressure: 0.00246 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: N#CCc1c(nc(OC)cc1)C
(2)InChI: InChI=1/C9H10N2O/c1-7-8(5-6-10)3-4-9(11-7)12-2/h3-4H,5H2,1-2H3
(3)InChIKey: DIWPDBFUFFUPCD-UHFFFAOYAO