The Benzenamine,3-bromo-5-methyl-, with the CAS registry number 74586-53-1, is also known as ZINC15021091. Its EINECS registry number is 277-932-1. This chemical's molecular formula is C₇H₈BrN and molecular weight is 186.04912. Its IUPAC name is called 3-bromo-5-methylaniline.

Physical properties of Benzenamine,3-bromo-5-methyl-: (1)ACD/LogP: 2.56; (2)ACD/LogD (pH 5.5): 2.55; (3)ACD/LogD (pH 7.4): 2.56; (4)ACD/BCF (pH 5.5): 51.24; (5)ACD/BCF (pH 7.4): 51.95; (6)ACD/KOC (pH 5.5): 580.31; (7)ACD/KOC (pH 7.4): 588.31; (8)#H bond acceptors: 1; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.609; (12)Molar Refractivity: 43 cm³; (13)Molar Volume: 124.1 cm³; (14)Surface Tension: 44.7 dyne/cm; (15)Density: 1.498 g/cm³; (16)Flash Point: 111.7 °C; (17)Enthalpy of Vaporization: 49.51 kJ/mol; (18)Boiling Point: 257.5 °C at 760 mmHg; (19)Vapour Pressure: 0.0145 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=CC(=CC(=C1)Br)N
(2)InChI: InChI=1S/C7H8BrN/c1-5-2-6(8)4-7(9)3-5/h2-4H,9H2,1H3
(3)InChIKey: YIZRPAWCIFTHNA-UHFFFAOYSA-N