The 4-Amino-2,6-dibromopyridine, with the CAS registry number 39771-34-1, is also known as 4-Pyridinamine, 2,6-dibromo-. This chemical's molecular formula is C₅H₄Br₂N₂ and molecular weight is 251.91. Its IUPAC name and systematic name are the same which is called 2,6-dibromopyridin-4-amine.

Physical properties about 4-Amino-2,6-dibromopyridine are: (1)ACD/LogP: 2.61; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.61; (4)ACD/LogD (pH 7.4): 2.61; (5)ACD/BCF (pH 5.5): 56.44; (6)ACD/BCF (pH 7.4): 56.44; (7)ACD/KOC (pH 5.5): 624.32; (8)ACD/KOC (pH 7.4): 624.33; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.672; (13)Molar Refractivity: 43.96 cm³; (14)Molar Volume: 117.3 cm³; (15)Surface Tension: 61.3 dyne/cm; (16)Density: 2.147 g/cm³; (17)Flash Point: 179.8 °C; (18)Enthalpy of Vaporization: 62.1 kJ/mol; (19)Boiling Point: 373.7 °C at 760 mmHg; (20)Vapour Pressure: 8.77E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(C=C(N=C1Br)Br)N
(2)InChI: InChI=1S/C5H4Br2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9)
(3)InChIKey: NTFZVUOMTODHRO-UHFFFAOYSA-N