The 4-Thiazolecarboxaldehyde,2-(2,4-dichlorophenyl)-, with the CAS registry number 150162-48-4, is also known as 2-(2,4-Dichlorophenyl)-1,3-thiazole-4-carbaldehyde. This chemical's molecular formula is C₁₀H₅Cl₂NOS and molecular weight is 258.12. Its systematic name is called 2-(2,4-dichlorophenyl)thiazole-4-carbaldehyde.

Physical properties of 4-Thiazolecarboxaldehyde,2-(2,4-dichlorophenyl)-: (1)ACD/LogP: 4.35; (2)ACD/LogD (pH 5.5): 4.347; (3)ACD/LogD (pH 7.4): 4.347; (4)ACD/BCF (pH 5.5): 1184.218; (5)ACD/BCF (pH 7.4): 1184.219; (6)ACD/KOC (pH 5.5): 5515.205; (7)ACD/KOC (pH 7.4): 5515.208; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.66; (11)Molar Refractivity: 63.863 cm³; (12)Molar Volume: 172.989 cm³; (13)Surface Tension: 56.719 dyne/cm; (14)Density: 1.492 g/cm³; (15)Flash Point: 200.988 °C; (16)Enthalpy of Vaporization: 66.079 kJ/mol; (17)Boiling Point: 408.722 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(c(cc1Cl)Cl)c2nc(cs2)C=O
(2)InChI: InChI=1/C10H5Cl2NOS/c11-6-1-2-8(9(12)3-6)10-13-7(4-14)5-15-10/h1-5H
(3)InChIKey: WHSDMIWQSPNIJB-UHFFFAOYAD