The 5-Bromothiazole-2-carboxylic acid is an organic compound with the formula C₄H₂BrNO₂S. The IUPAC name of this chemical is 5-bromo-1,3-thiazole-2-carboxylic acid. With the CAS registry number 957346-62-2, it is also named as 2-Thiazolecarboxylicacid, 5-bromo-. In addition, the molecular weight is 208.03.

The other characteristics of 5-Bromothiazole-2-carboxylic acid can be summarized as: (1)ACD/LogP: 1.34; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 78.43 Å²; (11)Index of Refraction: 1.663; (12)Molar Refractivity: 37.349 cm³; (13)Molar Volume: 100.851 cm³; (14)Polarizability: 14.806×10^-24 cm³; (15)Surface Tension: 75.422 dyne/cm; (16)Enthalpy of Vaporization: 65.372 kJ/mol; (17)Vapour Pressure: 0 mmHg at 25°C; (18)Rotatable Bond Count: 1; (19)Exact Mass: 206.898962; (20)MonoIsotopic Mass: 206.898962; (21)Topological Polar Surface Area: 78.4; (22)Heavy Atom Count: 9; (23)Complexity: 132.

People can use the following data to convert to the molecule structure. 
1. SMILES:c1c(sc(n1)C(=O)O)Br
2. InChI:InChI=1/C4H2BrNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)
3. InChIKey:BQRYPTVDLJGHAU-UHFFFAOYAE
4. InChI=1S/C4H2BrNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)
5. Std. InChIKey:BQRYPTVDLJGHAU-UHFFFAOYSA-N