The Quinazoline, 8-bromo-2,4-dichloro-, with the CAS registry number 331647-05-3, is also known as 2,4-Dichloro-8-bromoquinazoline. This chemical's molecular formula is C₈H₃BrCl₂N₂ and molecular weight is 277.93. What's more, its IUPAC name is 8-bromo-2,4-dichloroquinazoline.

Physical properties of Quinazoline, 8-bromo-2,4-dichloro- are: (1)ACD/LogP: 3.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.52; (4)ACD/BCF (pH 5.5): 277.1; (5)ACD/KOC (pH 5.5): 1950.04; (6)#H bond acceptors: 2; (7)#H bond donors: 0; (8)#Freely Rotating Bonds: 0; (9)Polar Surface Area: 25.78 Å²; (10)Index of Refraction: 1.696; (11)Molar Refractivity: 57.75 cm³; (12)Molar Volume: 150 cm³; (13)Polarizability: 22.89×10^-24cm³; (14)Surface Tension: 62.2 dyne/cm; (15)Density: 1.851 g/cm³; (16)Flash Point: 103.9 °C; (17)Enthalpy of Vaporization: 46.57 kJ/mol; (18)Boiling Point: 248.2 °C at 760 mmHg; (19)Vapour Pressure: 0.0388 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC2=C(C(=C1)Br)N=C(N=C2Cl)Cl
(2)InChI: InChI=1S/C8H3BrCl2N2/c9-5-3-1-2-4-6(5)12-8(11)13-7(4)10/h1-3H
(3)InChIKey: BHXJPWCPEFXWMH-UHFFFAOYSA-N