The 9,10-Dihydro-9-oxa-10-phosphaphenanthrene-10-propanoic acid methyl ester 10-oxide, with the CAS registry number 63562-42-5, is also known as 6H-Dibenz[c,e][1,2]oxaphosphorin-6-propanoic acid methyl ester 6-oxide. This chemical's molecular formula is C₁₆H₁₅O₄P and molecular weight is 302.264. Its systematic name is called methyl 3-(6-oxido-6H-dibenzo[c,e][1,2]oxaphosphinin-6-yl)propanoate.

Physical properties of 9,10-Dihydro-9-oxa-10-phosphaphenanthrene-10-propanoic acid methyl ester 10-oxide: (1)#H bond acceptors: 4; (2)#Freely Rotating Bonds: 4; (3)Polar Surface Area: 62.41 Å²; (4)Index of Refraction: 1.591; (5)Molar Refractivity: 78.26 cm³; (6)Molar Volume: 231.3 cm³; (7)Surface Tension: 52.1 dyne/cm; (8)Density: 1.3 g/cm³; (9)Flash Point: 256 °C; (10)Enthalpy of Vaporization: 74.19 kJ/mol; (11)Boiling Point: 477.9 °C at 760 mmHg; (12)Vapour Pressure: 2.69E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: COC(=O)CCP2(=O)Oc3ccccc3c1ccccc12
(2)InChI: InChI=1/C16H15O4P/c1-19-16(17)10-11-21(18)15-9-5-3-7-13(15)12-6-2-4-8-14(12)20-21/h2-9H,10-11H2,1H3
(3)InChIKey: DYZCIFRVAXREBL-UHFFFAOYAA