The Acetanilide, 4'-methoxy-2,2,2-trifluoro-, with the CAS registry number 332-34-3, is also known as 4-Methoxy-2,2,2-trifluoroacetanilide. This chemical's molecular formula is C₉H₈F₃NO₂ and molecular weight is 219.16. What's more, its systematic name is 2,2,2-trifluoro-N-(4-methoxyphenyl)acetamide. Its classification code is Drug/Therapeutic Agent. 

Physical properties of Acetanilide, 4'-methoxy-2,2,2-trifluoro- are: (1)ACD/LogP: 2.22; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.22; (4)ACD/BCF (pH 5.5): 28.69; (5)ACD/BCF (pH 7.4): 28.45; (6)ACD/KOC (pH 5.5): 384.67; (7)ACD/KOC (pH 7.4): 381.44; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 29.54 Å²; (12)Index of Refraction: 1.496; (13)Molar Refractivity: 47.66 cm³; (14)Molar Volume: 162.9 cm³; (15)Polarizability: 18.89×10^-24cm³; (16)Surface Tension: 33.2 dyne/cm; (17)Density: 1.345 g/cm³; (18)Flash Point: 128.9 °C; (19)Enthalpy of Vaporization: 52.88 kJ/mol; (20)Boiling Point: 289.4 °C at 760 mmHg; (21)Vapour Pressure: 0.0022 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC=C(C=C1)NC(=O)C(F)(F)F
(2)InChI: InChI=1S/C9H8F3NO2/c1-15-7-4-2-6(3-5-7)13-8(14)9(10,11)12/h2-5H,1H3,(H,13,14)
(3)InChIKey: OUTSPSLYNAJENA-UHFFFAOYSA-N

The toxicity data is as follows: