The Acetylpyruvic acid, with the CAS registry number 5699-58-1, is also known as Pentanoic acid, 2,4-dioxo-. Its EINECS registry number is 227-181-0. This chemical's molecular formula is C₅H₆O₄ and molecular weight is 130.09874. Its IUPAC name is called 2,4-dioxopentanoic acid.

Physical properties of Acetylpyruvic acid: (1)ACD/LogP: -1.47; (2)ACD/LogD (pH 5.5): -4.63; (3)ACD/LogD (pH 7.4): -5.28; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.449; (12)Molar Refractivity: 26.83 cm³; (13)Molar Volume: 99.9 cm³; (14)Surface Tension: 47.9 dyne/cm; (15)Density: 1.301 g/cm³; (16)Flash Point: 110.5 °C; (17)Enthalpy of Vaporization: 52.01 kJ/mol; (18)Boiling Point: 235.5 °C at 760 mmHg; (19)Vapour Pressure: 0.0172 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(=O)CC(=O)C(=O)O
(2)InChI: InChI=1S/C5H6O4/c1-3(6)2-4(7)5(8)9/h2H2,1H3,(H,8,9)
(3)InChIKey: UNRQTHVKJQUDDF-UHFFFAOYSA-N