The Benzeneaceticacid, 3-chloro-, hydrazide, with the CAS registry number 66464-86-6, is also known as 3-Chlorophenylacetylhydrazide. This chemical's molecular formula is C₈H₉ClN₂O and molecular weight is 184.6229. Its systematic name is called 2-(3-chlorophenyl)acetohydrazide.

Physical properties of Benzeneaceticacid, 3-chloro-, hydrazide: (1)ACD/LogP: 0.73; (2)ACD/LogD (pH 5.5): 0.73; (3)ACD/LogD (pH 7.4): 0.73; (4)ACD/BCF (pH 5.5): 2.12; (5)ACD/BCF (pH 7.4): 2.13; (6)ACD/KOC (pH 5.5): 59.54; (7)ACD/KOC (pH 7.4): 59.73; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.579; (12)Molar Refractivity: 47.85 cm³; (13)Molar Volume: 143.8 cm³; (14)Surface Tension: 49.6 dyne/cm; (15)Density: 1.283 g/cm³; (16)Flash Point: 192.6 °C; (17)Enthalpy of Vaporization: 64.5 kJ/mol; (18)Boiling Point: 394.9 °C at 760 mmHg; (19)Vapour Pressure: 1.91E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc(ccc1)CC(=O)NN
(2)InChI: InChI=1/C8H9ClN2O/c9-7-3-1-2-6(4-7)5-8(12)11-10/h1-4H,5,10H2,(H,11,12)
(3)InChIKey: RTQCXLTUAIZZQP-UHFFFAOYAR