The CAS registry number of Benzenesulfonamide,3,4-diamino-N,N-diethyl- is 49804-28-6. Its molecular formula is C₁₀H₁₇N₃O₂S and molecular weight is 243.3259. Its systematic name and IUPAC name are the same which is called 3,4-Diamino-N,N-diethylbenzenesulfonamide.

Physical properties about Benzenesulfonamide,3,4-diamino-N,N-diethyl- are: (1)ACD/LogP: 0.61; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 6; (6)Index of Refraction: 1.592; (7)Molar Refractivity: 65.2 cm³; (8)Molar Volume: 192.5 cm³; (9)Surface Tension: 55.5 dyne/cm; (10)Density: 1.263 g/cm³; (11)Flash Point: 215 °C; (12)Enthalpy of Vaporization: 68.76 kJ/mol; (13)Boiling Point: 431.9 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1cc(N)c(N)cc1)N(CC)CC
(2)InChI: InChI=1/C10H17N3O2S/c1-3-13(4-2)16(14,15)8-5-6-9(11)10(12)7-8/h5-7H,3-4,11-12H2,1-2H3
(3)InChIKey: AMLGOCJQWVBKMR-UHFFFAOYAAS36/37/39