The CAS registry number of Benzenesulfonic acid,2-(aminocarbonyl)hydrazide is 10195-68-3. This chemical is also named as Benzenesulfonyl semicarbazide. In addition, its molecular formula is C₇H₉N₃O₃S and molecular weight is 215.22966. Its systematic name is called 2-(phenylsulfonyl)hydrazinecarboxamide.

Physical properties about Benzenesulfonic acid,2-(aminocarbonyl)hydrazide are: (1)ACD/LogP: -0.28; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.28; (4)ACD/LogD (pH 7.4): -0.37; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 16.79; (8)ACD/KOC (pH 7.4): 13.51; (9)#H bond acceptors: 6; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.6; (13)Molar Refractivity: 51.24 cm³; (14)Molar Volume: 149.6 cm³; (15)Surface Tension: 59 dyne/cm; (16)Density: 1.438 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(NNC(=O)N)c1ccccc1
(2)InChI: InChI=1/C7H9N3O3S/c8-7(11)9-10-14(12,13)6-4-2-1-3-5-6/h1-5,10H,(H3,8,9,11)
(3)InChIKey: LSNDGFYQJRXEAR-UHFFFAOYAJ