The Bis((tridecafluoro-1, 1, 2, 2-tetrahydrooctyl)dimethylsiloxy)methylsilane, with the CAS registry number 521069-00-1, is also known as 1, 1, 3, 5, 5-Pentamethyl-1, 5-bis(3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 8-tridecafluorooctyl)trisiloxane. This chemical's molecular formula is C₂₁H₂₄F₂₆O₂Si₃ and molecular weight is 886.63. What's more, its systematic name is Bis[[dimethyl(3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 8-tridecafluorooctyl)silyl]oxy]-methyl-silane. In addition, physical properties about Bis((tridecafluoro-1, 1, 2, 2-tetrahydrooctyl)dimethylsiloxy)methylsilane are (1)Density: 1.414 g/cm³; (2)Boiling Point: 136 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1) SMILES: C[SiH](O[Si](C)(C)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O[Si](C)(C)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
(2) InChI: InChI=1/C21H24F26O2Si3/c1-50(48-51(2,3)8-6-10(22,23)12(26,27)14(30,31)16(34,35)18(38,39)20(42,43)44)49-52(4,5)9-7-11(24,25)13(28,29)15(32,33)17(36,37)19(40,41)21(45,46)47/h50H,6-9H2,1-5H3
(3) InChIKey: VSLHCOZVHMYAKT-UHFFFAOYAW