The Glycine,N-(4-chlorophenyl)-, hydrazide, with the CAS registry number 2371-31-5, is also known as (4-Chloro-phenylamino)-acetic acid hydrazide. This chemical's molecular formula is C₈H₁₀ClN₃O and molecular weight is 199.6375. Its IUPAC name is called 2-(4-chloroanilino)acetohydrazide.

Physical properties of Glycine,N-(4-chlorophenyl)-, hydrazide: (1)ACD/LogP: 0.22; (2)#H bond acceptors: 4; (3)#H bond donors: 4; (4)#Freely Rotating Bonds: 4; (5)Index of Refraction: 1.633; (6)Molar Refractivity: 52.55 cm³; (7)Molar Volume: 146.9 cm³; (8)Surface Tension: 57 dyne/cm; (9)Density: 1.358 g/cm³; (10)Flash Point: 248.1 °C; (11)Enthalpy of Vaporization: 75.25 kJ/mol; (12)Boiling Point: 486.7 °C at 760 mmHg; (13)Vapour Pressure: 1.26E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=CC=C1NCC(=O)NN)Cl
(2)InChI: InChI=1S/C8H10ClN3O/c9-6-1-3-7(4-2-6)11-5-8(13)12-10/h1-4,11H,5,10H2,(H,12,13)
(3)InChIKey: RGWSDFHTYZOJAY-UHFFFAOYSA-N