The CAS registry number of L-Kynurenine sulfate is 13535-93-8. This chemical's molecular formula is C₁₀H₁₄N₂O₇S and molecular weight is 306.29236. Its IUPAC name is called 2-amino-4-(2-aminophenyl)-4-oxobutanoic acid; sulfuric acid. In addition, this chemical is light yellow crystalline.

Physical properties of L-Kynurenine sulfate: (1)ACD/LogP: 1.09; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -1.39; (4)ACD/LogD (pH 7.4): -1.55; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 5; (11)#Freely Rotating Bonds: 6; (12)Flash Point: 236 °C; (13)Enthalpy of Vaporization: 76.74 kJ/mol; (14)Boiling Point: 466.6 °C at 760 mmHg; (15)Vapour Pressure: 1.66E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)N.OS(=O)(=O)O
(2)InChI: InChI=1S/C10H12N2O3.H2O4S/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15;1-5(2,3)4/h1-4,8H,5,11-12H2,(H,14,15);(H2,1,2,3,4)
(3)InChIKey: KAXRWMOLNJZCEW-UHFFFAOYSA-N