The Dimethyltin bis(2-ethylhexyl thioglycolate), with the CAS registry number 57583-35-4, is also known as 8-Oxa-3,5-dithia-4-stannatetradecanoic acid, 10-ethyl-4,4-dimethyl-7-oxo-, 2-ethylhexyl ester. Its EINECS registry number is 260-829-0. This chemical's molecular formula is C₂₂H₄₄O₄S₂Sn and molecular weight is 555.43. Its IUPAC name is called 2-ethylhexyl 2-[[2-(2-ethylhexoxy)-2-oxoethyl]sulfanyl-dimethylstannyl] sulfanylacetate. This chemical is used as PVC thermal stabilizer in machining process.

Physical properties of Dimethyltin bis(2-ethylhexyl thioglycolate): (1)ACD/LogP: 12.82; (2)# of Rule of 5 Violations: 2; (3)ACD/LogD (pH 5.5): 12.82; (4)ACD/LogD (pH 7.4): 12.82; (5)ACD/BCF (pH 5.5): 1000000; (6)ACD/BCF (pH 7.4): 1000000; (7)ACD/KOC (pH 5.5): 10000000; (8)ACD/KOC (pH 7.4): 10000000; (9)#H bond acceptors: 4; (10)#Freely Rotating Bonds: 20; (11)Flash Point: 265.6 °C; (12)Enthalpy of Vaporization: 78.75 kJ/mol; (13)Boiling Point: 515.6 °C at 760 mmHg; (14)Vapour Pressure: 9.67E-11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCC(CC)COC(=O)CS[Sn](C)(C)SCC(=O)OCC(CC)CCCC
(2)InChI: InChI=1S/2C10H20O2S.2CH3.Sn/c2*1-3-5-6-9(4-2)7-12-10(11)8-13;;;/h2*9,13H,3-8H2,1-2H3;2*1H3;/q;;;;+2/p-2
(3)InChIKey: YAHBZWSDRFSFOO-UHFFFAOYSA-L