The N,N-Dimethylcyclohexane-1,4-diamine, with the CAS registry number 42389-50-4, is also known as 1,4-cyclohexanediamine, N¹,N¹-dimethyl-. This chemical's molecular formula is C₈H₁₈N₂ and molecular weight is 142.24. Its IUPAC name and systematic name are the same which is called N,N-dimethylcyclohexane-1,4-diamine.

Physical properties about N,N-Dimethylcyclohexane-1,4-diamine are: (1)ACD/LogP: 0.47; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 6.48 Å²; (7)Index of Refraction: 1.49; (8)Molar Refractivity: 44.49 cm³; (9)Molar Volume: 153.8 cm³; (10)Surface Tension: 34.4 dyne/cm; (11)Density: 0.92 g/cm³; (12)Flash Point: 64 °C; (13)Enthalpy of Vaporization: 42.05 kJ/mol; (14)Boiling Point: 184.3 °C at 760 mmHg; (15)Vapour Pressure: 0.739 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: NC1CCC(N(C)C)CC1
(2)InChI: InChI=1/C8H18N2/c1-10(2)8-5-3-7(9)4-6-8/h7-8H,3-6,9H2,1-2H3
(3)InChIKey: GNGZZWTXFNFCMU-UHFFFAOYAL