The CAS registry number of Propanenitrile, 3-[(3-methoxyphenyl)amino]- is 26424-07-7. This chemical is also named as 3-[(3-Methoxyphenyl)amino]propanenitrile. In addition, its molecular formula is C₁₀H₁₂N₂O and molecular weight is 176.2151. Its systematic name and IUPAC name are the same which is called 3-(3-methoxyanilino)propanenitrile.

Physical properties about Propanenitrile, 3-[(3-methoxyphenyl)amino]- are: (1)ACD/LogP: 0.65; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 4; (6)Index of Refraction: 1.562; (7)Molar Refractivity: 51.72 cm³; (8)Molar Volume: 159.2 cm³; (9)Surface Tension: 44.1 dyne/cm; (10)Density: 1.106 g/cm³; (11)Flash Point: 180.1 °C; (12)Enthalpy of Vaporization: 62.15 kJ/mol; (13)Boiling Point: 374.1 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: N#CCCNc1cccc(OC)c1
(2)InChI: InChI=1/C10H12N2O/c1-13-10-5-2-4-9(8-10)12-7-3-6-11/h2,4-5,8,12H,3,7H2,1H3
(3)InChIKey: SJJLNXJJMNKZKF-UHFFFAOYAL